C4H2F6S2 — CID 91568617
1,1,1,4,4,4-hexafluoro-3-sulfanylbutane-2-thione (PubChem CID 91568617) has the molecular formula C4H2F6S2 and a molecular weight of 228.18 g/mol. Its IUPAC name is 1,1,1,4,4,4-hexafluoro-3-sulfanylbutane-2-thione.
| Compound Name | 1,1,1,4,4,4-hexafluoro-3-sulfanylbutane-2-thione |
|---|---|
| PubChem CID | 91568617 |
| Molecular Formula | C4H2F6S2 |
| Molecular Weight | 228.18 g/mol |
| Exact Mass | 227.95 |
| IUPAC Name | 1,1,1,4,4,4-hexafluoro-3-sulfanylbutane-2-thione |
| SMILES | FC(F)(F)C(=S)C(S)C(F)(F)F |
| InChI | InChI=1S/C4H2F6S2/c5-3(6,7)1(11)2(12)4(8,9)10/h1,11H |
| InChIKey | NJZLBARNABTSMI-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.18 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|