About 1,3-dicyclohexyl-2,5-dimethylbenzene
1,3-dicyclohexyl-2,5-dimethylbenzene (PubChem CID 91568948) has the molecular formula C20H30
and a molecular weight of 270.46 g/mol. Its IUPAC name is 1,3-dicyclohexyl-2,5-dimethylbenzene.
Molecular Properties
| Compound Name | 1,3-dicyclohexyl-2,5-dimethylbenzene |
| PubChem CID | 91568948 |
| Molecular Formula | C20H30 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | 1,3-dicyclohexyl-2,5-dimethylbenzene |
| SMILES | Cc1cc(C2CCCCC2)c(C)c(C2CCCCC2)c1 |
| InChI | InChI=1S/C20H30/c1-15-13-19(17-9-5-3-6-10-17)16(2)20(14-15)18-11-7-4-8-12-18/h13-14,17-18H,3-12H2,1-2H3 |
| InChIKey | AQCGHFUTVHGGHG-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,3-dicyclohexyl-2,5-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dicyclohexyl-2,5-dimethylbenzene?
The IUPAC name of 1,3-dicyclohexyl-2,5-dimethylbenzene (CID 91568948) is 1,3-dicyclohexyl-2,5-dimethylbenzene.
What is the SMILES notation for 1,3-dicyclohexyl-2,5-dimethylbenzene?
The canonical SMILES for 1,3-dicyclohexyl-2,5-dimethylbenzene is Cc1cc(C2CCCCC2)c(C)c(C2CCCCC2)c1.
What is the InChIKey of 1,3-dicyclohexyl-2,5-dimethylbenzene?
The InChIKey is AQCGHFUTVHGGHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30/c1-15-13-19(17-9-5-3-6-10-17)16(2)20(14-15)18-11-7-4-8-12-18/h13-14,17-18H,3-12H2,1-2H3.
What are the key properties of 1,3-dicyclohexyl-2,5-dimethylbenzene?
1,3-dicyclohexyl-2,5-dimethylbenzene has a molecular weight of 270.46 g/mol, XLogP of 6.40, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dicyclohexyl-2,5-dimethylbenzene is sourced from PubChem (CID 91568948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).