About ethane;2-methyltriphenylene
ethane;2-methyltriphenylene (PubChem CID 91569125) has the molecular formula C21H20
and a molecular weight of 272.39 g/mol. Its IUPAC name is ethane;2-methyltriphenylene.
Molecular Properties
| Compound Name | ethane;2-methyltriphenylene |
| PubChem CID | 91569125 |
| Molecular Formula | C21H20 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | ethane;2-methyltriphenylene |
| SMILES | CC.Cc1ccc2c3ccccc3c3ccccc3c2c1 |
| InChI | InChI=1S/C19H14.C2H6/c1-13-10-11-18-16-8-3-2-6-14(16)15-7-4-5-9-17(15)19(18)12-13;1-2/h2-12H,1H3;1-2H3 |
| InChIKey | IXKVQFYXBSQXNW-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-methyltriphenylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methyltriphenylene?
The IUPAC name of ethane;2-methyltriphenylene (CID 91569125) is ethane;2-methyltriphenylene.
What is the SMILES notation for ethane;2-methyltriphenylene?
The canonical SMILES for ethane;2-methyltriphenylene is CC.Cc1ccc2c3ccccc3c3ccccc3c2c1.
What is the InChIKey of ethane;2-methyltriphenylene?
The InChIKey is IXKVQFYXBSQXNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14.C2H6/c1-13-10-11-18-16-8-3-2-6-14(16)15-7-4-5-9-17(15)19(18)12-13;1-2/h2-12H,1H3;1-2H3.
What are the key properties of ethane;2-methyltriphenylene?
ethane;2-methyltriphenylene has a molecular weight of 272.39 g/mol, XLogP of 6.48, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methyltriphenylene is sourced from PubChem (CID 91569125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).