C27H31F6NO2 — CID 91569361
2-[(2S,4S)-2-[4-(trifluoromethyl)phenyl]-1-[(1R)-1-[4-(trifluoromethyl)phenyl]hexyl]piperidin-4-yl]acetic acid (PubChem CID 91569361) has the molecular formula C27H31F6NO2 and a molecular weight of 515.54 g/mol. Its IUPAC name is 2-[(2S,4S)-2-[4-(trifluoromethyl)phenyl]-1-[(1R)-1-[4-(trifluoromethyl)phenyl]hexyl]piperidin-4-yl]acetic acid.
| Compound Name | 2-[(2S,4S)-2-[4-(trifluoromethyl)phenyl]-1-[(1R)-1-[4-(trifluoromethyl)phenyl]hexyl]piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 91569361 |
| Molecular Formula | C27H31F6NO2 |
| Molecular Weight | 515.54 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | 2-[(2S,4S)-2-[4-(trifluoromethyl)phenyl]-1-[(1R)-1-[4-(trifluoromethyl)phenyl]hexyl]piperidin-4-yl]acetic acid |
| SMILES | CCCCC[C@H](c1ccc(C(F)(F)F)cc1)N1CC[C@H](CC(=O)O)C[C@H]1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H31F6NO2/c1-2-3-4-5-23(19-6-10-21(11-7-19)26(28,29)30)34-15-14-18(17-25(35)36)16-24(34)20-8-12-22(13-9-20)27(31,32)33/h6-13,18,23-24H,2-5,14-17H2,1H3,(H,35,36)/t18-,23+,24-/m0/s1 |
| InChIKey | MLVDIUIMIAJNCX-GLYQVZKVSA-N |
| XLogP | 8.27 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.54 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|