C24H32FN5O2S2 — CID 91569461
[5-fluoro-2-[(2-piperazin-1-yl-4-sulfanylidene-1,3-thiazol-5-ylidene)methyl]phenyl] 4-(diethylamino)piperidine-1-carboxylate (PubChem CID 91569461) has the molecular formula C24H32FN5O2S2 and a molecular weight of 505.69 g/mol. Its IUPAC name is [5-fluoro-2-[(2-piperazin-1-yl-4-sulfanylidene-1,3-thiazol-5-ylidene)methyl]phenyl] 4-(diethylamino)piperidine-1-carboxylate.
| Compound Name | [5-fluoro-2-[(2-piperazin-1-yl-4-sulfanylidene-1,3-thiazol-5-ylidene)methyl]phenyl] 4-(diethylamino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 91569461 |
| Molecular Formula | C24H32FN5O2S2 |
| Molecular Weight | 505.69 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | [5-fluoro-2-[(2-piperazin-1-yl-4-sulfanylidene-1,3-thiazol-5-ylidene)methyl]phenyl] 4-(diethylamino)piperidine-1-carboxylate |
| SMILES | CCN(CC)C1CCN(C(=O)Oc2cc(F)ccc2C=C2SC(N3CCNCC3)=NC2=S)CC1 |
| InChI | InChI=1S/C24H32FN5O2S2/c1-3-28(4-2)19-7-11-30(12-8-19)24(31)32-20-16-18(25)6-5-17(20)15-21-22(33)27-23(34-21)29-13-9-26-10-14-29/h5-6,15-16,19,26H,3-4,7-14H2,1-2H3 |
| InChIKey | IJHDPBADCCFWLY-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 60.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.69 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|