C24H26N4O3S — CID 91570658
ethyl 4-oxo-4-[3-[[(1R)-1-phenylpropyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-enoate (PubChem CID 91570658) has the molecular formula C24H26N4O3S and a molecular weight of 450.56 g/mol. Its IUPAC name is ethyl 4-oxo-4-[3-[[(1R)-1-phenylpropyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-enoate.
| Compound Name | ethyl 4-oxo-4-[3-[[(1R)-1-phenylpropyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-enoate |
|---|---|
| PubChem CID | 91570658 |
| Molecular Formula | C24H26N4O3S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | ethyl 4-oxo-4-[3-[[(1R)-1-phenylpropyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-enoate |
| SMILES | CCOC(=O)C=CC(=O)N1CCc2c(sc3ncnc(N[C@H](CC)c4ccccc4)c23)C1 |
| InChI | InChI=1S/C24H26N4O3S/c1-3-18(16-8-6-5-7-9-16)27-23-22-17-12-13-28(20(29)10-11-21(30)31-4-2)14-19(17)32-24(22)26-15-25-23/h5-11,15,18H,3-4,12-14H2,1-2H3,(H,25,26,27)/t18-/m1/s1 |
| InChIKey | NPPTVXIXFVKZAH-GOSISDBHSA-N |
| XLogP | 4.26 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|