C24H24N6O3 — CID 91570828
5-hydroxy-2-(2-morpholin-4-ylethylamino)-6-[4-(2-pyridin-3-ylethynyl)phenyl]pyrimidine-4-carboxamide (PubChem CID 91570828) has the molecular formula C24H24N6O3 and a molecular weight of 444.50 g/mol. Its IUPAC name is 5-hydroxy-2-(2-morpholin-4-ylethylamino)-6-[4-(2-pyridin-3-ylethynyl)phenyl]pyrimidine-4-carboxamide.
| Compound Name | 5-hydroxy-2-(2-morpholin-4-ylethylamino)-6-[4-(2-pyridin-3-ylethynyl)phenyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 91570828 |
| Molecular Formula | C24H24N6O3 |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | 5-hydroxy-2-(2-morpholin-4-ylethylamino)-6-[4-(2-pyridin-3-ylethynyl)phenyl]pyrimidine-4-carboxamide |
| SMILES | NC(=O)c1nc(NCCN2CCOCC2)nc(-c2ccc(C#Cc3cccnc3)cc2)c1O |
| InChI | InChI=1S/C24H24N6O3/c25-23(32)21-22(31)20(28-24(29-21)27-10-11-30-12-14-33-15-13-30)19-7-5-17(6-8-19)3-4-18-2-1-9-26-16-18/h1-2,5-9,16,31H,10-15H2,(H2,25,32)(H,27,28,29) |
| InChIKey | WWMKPMNJSDKKSY-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 126.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.50 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|