C19H17ClF4NO2+ — CID 91571711
5-chloro-2-(2-methoxyethyl)-2-[2,2,2-trifluoro-1-(3-fluorophenyl)ethyl]-3H-isoindol-2-ium-1-one (PubChem CID 91571711) has the molecular formula C19H17ClF4NO2+ and a molecular weight of 402.80 g/mol. Its IUPAC name is 5-chloro-2-(2-methoxyethyl)-2-[2,2,2-trifluoro-1-(3-fluorophenyl)ethyl]-3H-isoindol-2-ium-1-one.
| Compound Name | 5-chloro-2-(2-methoxyethyl)-2-[2,2,2-trifluoro-1-(3-fluorophenyl)ethyl]-3H-isoindol-2-ium-1-one |
|---|---|
| PubChem CID | 91571711 |
| Molecular Formula | C19H17ClF4NO2+ |
| Molecular Weight | 402.80 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | 5-chloro-2-(2-methoxyethyl)-2-[2,2,2-trifluoro-1-(3-fluorophenyl)ethyl]-3H-isoindol-2-ium-1-one |
| SMILES | COCC[N+]1(C(c2cccc(F)c2)C(F)(F)F)Cc2cc(Cl)ccc2C1=O |
| InChI | InChI=1S/C19H17ClF4NO2/c1-27-8-7-25(11-13-9-14(20)5-6-16(13)18(25)26)17(19(22,23)24)12-3-2-4-15(21)10-12/h2-6,9-10,17H,7-8,11H2,1H3/q+1 |
| InChIKey | JLBISEOCEKYDHX-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.80 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|