C18H15N3O — CID 915720
3-benzyl-8-methyl-5H-pyrimido[5,4-b]indol-4-one (PubChem CID 915720) has the molecular formula C18H15N3O and a molecular weight of 289.34 g/mol. Its IUPAC name is 3-benzyl-8-methyl-5H-pyrimido[5,4-b]indol-4-one.
| Compound Name | 3-benzyl-8-methyl-5H-pyrimido[5,4-b]indol-4-one |
|---|---|
| PubChem CID | 915720 |
| Molecular Formula | C18H15N3O |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 3-benzyl-8-methyl-5H-pyrimido[5,4-b]indol-4-one |
| SMILES | Cc1ccc2[nH]c3c(=O)n(Cc4ccccc4)cnc3c2c1 |
| InChI | InChI=1S/C18H15N3O/c1-12-7-8-15-14(9-12)16-17(20-15)18(22)21(11-19-16)10-13-5-3-2-4-6-13/h2-9,11,20H,10H2,1H3 |
| InChIKey | YFQJVLXSFBOTSM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |