C17H24NO4- — CID 9157229
(2R)-3-methyl-2-[[2-(3-methyl-4-propan-2-ylphenoxy)acetyl]amino]butanoate (PubChem CID 9157229) has the molecular formula C17H24NO4- and a molecular weight of 306.38 g/mol. Its IUPAC name is (2R)-3-methyl-2-[[2-(3-methyl-4-propan-2-ylphenoxy)acetyl]amino]butanoate.
| Compound Name | (2R)-3-methyl-2-[[2-(3-methyl-4-propan-2-ylphenoxy)acetyl]amino]butanoate |
|---|---|
| PubChem CID | 9157229 |
| Molecular Formula | C17H24NO4- |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | (2R)-3-methyl-2-[[2-(3-methyl-4-propan-2-ylphenoxy)acetyl]amino]butanoate |
| SMILES | Cc1cc(OCC(=O)N[C@@H](C(=O)[O-])C(C)C)ccc1C(C)C |
| InChI | InChI=1S/C17H25NO4/c1-10(2)14-7-6-13(8-12(14)5)22-9-15(19)18-16(11(3)4)17(20)21/h6-8,10-11,16H,9H2,1-5H3,(H,18,19)(H,20,21)/p-1/t16-/m1/s1 |
| InChIKey | TUEVQBGEBSUEBV-MRXNPFEDSA-M |
| XLogP | 1.39 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |