C31H41NO7S2 — CID 91572724
[5-tert-butyl-4-[6-cyclopentyl-6-[2-(3-hydroxyphenyl)ethyl]-2,4-dioxooxan-3-yl]sulfanyl-2-methylphenyl] N-ethylsulfamate (PubChem CID 91572724) has the molecular formula C31H41NO7S2 and a molecular weight of 603.80 g/mol. Its IUPAC name is [5-tert-butyl-4-[6-cyclopentyl-6-[2-(3-hydroxyphenyl)ethyl]-2,4-dioxooxan-3-yl]sulfanyl-2-methylphenyl] N-ethylsulfamate.
| Compound Name | [5-tert-butyl-4-[6-cyclopentyl-6-[2-(3-hydroxyphenyl)ethyl]-2,4-dioxooxan-3-yl]sulfanyl-2-methylphenyl] N-ethylsulfamate |
|---|---|
| PubChem CID | 91572724 |
| Molecular Formula | C31H41NO7S2 |
| Molecular Weight | 603.80 g/mol |
| Exact Mass | 603.23 |
| IUPAC Name | [5-tert-butyl-4-[6-cyclopentyl-6-[2-(3-hydroxyphenyl)ethyl]-2,4-dioxooxan-3-yl]sulfanyl-2-methylphenyl] N-ethylsulfamate |
| SMILES | CCNS(=O)(=O)Oc1cc(C(C)(C)C)c(SC2C(=O)CC(CCc3cccc(O)c3)(C3CCCC3)OC2=O)cc1C |
| InChI | InChI=1S/C31H41NO7S2/c1-6-32-41(36,37)39-26-18-24(30(3,4)5)27(16-20(26)2)40-28-25(34)19-31(38-29(28)35,22-11-7-8-12-22)15-14-21-10-9-13-23(33)17-21/h9-10,13,16-18,22,28,32-33H,6-8,11-12,14-15,19H2,1-5H3 |
| InChIKey | OHGWNGDZTQQQDP-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.80 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|