C14H25N — CID 91573833
2,7,9,10-tetramethyl-1,2,3,4,6,7,8,10a-octahydropyrido[1,2-a]azepine (PubChem CID 91573833) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is 2,7,9,10-tetramethyl-1,2,3,4,6,7,8,10a-octahydropyrido[1,2-a]azepine.
| Compound Name | 2,7,9,10-tetramethyl-1,2,3,4,6,7,8,10a-octahydropyrido[1,2-a]azepine |
|---|---|
| PubChem CID | 91573833 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | 2,7,9,10-tetramethyl-1,2,3,4,6,7,8,10a-octahydropyrido[1,2-a]azepine |
| SMILES | CC1=C(C)C2CC(C)CCN2CC(C)C1 |
| InChI | InChI=1S/C14H25N/c1-10-5-6-15-9-11(2)7-12(3)13(4)14(15)8-10/h10-11,14H,5-9H2,1-4H3 |
| InChIKey | YDFOHRIJWAHHRI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|