About butan-2-imine;butan-2-ol;2,3-dimethyl-1,4-dihydronaphthalene
butan-2-imine;butan-2-ol;2,3-dimethyl-1,4-dihydronaphthalene (PubChem CID 91573857) has the molecular formula C20H33NO
and a molecular weight of 303.49 g/mol. Its IUPAC name is butan-2-imine;butan-2-ol;2,3-dimethyl-1,4-dihydronaphthalene.
Molecular Properties
| Compound Name | butan-2-imine;butan-2-ol;2,3-dimethyl-1,4-dihydronaphthalene |
| PubChem CID | 91573857 |
| Molecular Formula | C20H33NO |
| Molecular Weight | 303.49 g/mol |
| Exact Mass | 303.26 |
| IUPAC Name | butan-2-imine;butan-2-ol;2,3-dimethyl-1,4-dihydronaphthalene |
| SMILES | CC1=C(C)Cc2ccccc2C1.CCC(C)O.[H]/N=C(\C)CC |
| InChI | InChI=1S/C12H14.C4H9N.C4H10O/c1-9-7-11-5-3-4-6-12(11)8-10(9)2;2*1-3-4(2)5/h3-6H,7-8H2,1-2H3;5H,3H2,1-2H3;4-5H,3H2,1-2H3/b;5-4+; |
| InChIKey | GWVRKAQHDRDFSB-YHVJRZKVSA-N |
| XLogP | 5.33 |
| TPSA | 44.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 303.49 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze butan-2-imine;butan-2-ol;2,3-dimethyl-1,4-dihydronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-imine;butan-2-ol;2,3-dimethyl-1,4-dihydronaphthalene?
The IUPAC name of butan-2-imine;butan-2-ol;2,3-dimethyl-1,4-dihydronaphthalene (CID 91573857) is butan-2-imine;butan-2-ol;2,3-dimethyl-1,4-dihydronaphthalene.
What is the SMILES notation for butan-2-imine;butan-2-ol;2,3-dimethyl-1,4-dihydronaphthalene?
The canonical SMILES for butan-2-imine;butan-2-ol;2,3-dimethyl-1,4-dihydronaphthalene is CC1=C(C)Cc2ccccc2C1.CCC(C)O.[H]/N=C(\C)CC.
What is the InChIKey of butan-2-imine;butan-2-ol;2,3-dimethyl-1,4-dihydronaphthalene?
The InChIKey is GWVRKAQHDRDFSB-YHVJRZKVSA-N. The full InChI is InChI=1S/C12H14.C4H9N.C4H10O/c1-9-7-11-5-3-4-6-12(11)8-10(9)2;2*1-3-4(2)5/h3-6H,7-8H2,1-2H3;5H,3H2,1-2H3;4-5H,3H2,1-2H3/b;5-4+;.
What are the key properties of butan-2-imine;butan-2-ol;2,3-dimethyl-1,4-dihydronaphthalene?
butan-2-imine;butan-2-ol;2,3-dimethyl-1,4-dihydronaphthalene has a molecular weight of 303.49 g/mol, XLogP of 5.33, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-imine;butan-2-ol;2,3-dimethyl-1,4-dihydronaphthalene is sourced from PubChem (CID 91573857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).