C12H16S — CID 91574683
3-methylidene-2-penta-1,3-dien-2-ylsulfanylhexa-1,4-diene (PubChem CID 91574683) has the molecular formula C12H16S and a molecular weight of 192.33 g/mol. Its IUPAC name is 3-methylidene-2-penta-1,3-dien-2-ylsulfanylhexa-1,4-diene.
| Compound Name | 3-methylidene-2-penta-1,3-dien-2-ylsulfanylhexa-1,4-diene |
|---|---|
| PubChem CID | 91574683 |
| Molecular Formula | C12H16S |
| Molecular Weight | 192.33 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 3-methylidene-2-penta-1,3-dien-2-ylsulfanylhexa-1,4-diene |
| SMILES | C=C(C=CC)SC(=C)C(=C)C=CC |
| InChI | InChI=1S/C12H16S/c1-6-8-10(3)12(5)13-11(4)9-7-2/h6-9H,3-5H2,1-2H3 |
| InChIKey | UXBZQUMTODHMBT-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.33 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|