C23H25N7O2 — CID 91574694
2-[4-[[[1-(3-methoxyphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]diazenyl]methyl]phenoxy]-N,N-dimethylethanamine (PubChem CID 91574694) has the molecular formula C23H25N7O2 and a molecular weight of 431.50 g/mol. Its IUPAC name is 2-[4-[[[1-(3-methoxyphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]diazenyl]methyl]phenoxy]-N,N-dimethylethanamine.
| Compound Name | 2-[4-[[[1-(3-methoxyphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]diazenyl]methyl]phenoxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 91574694 |
| Molecular Formula | C23H25N7O2 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | 2-[4-[[[1-(3-methoxyphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]diazenyl]methyl]phenoxy]-N,N-dimethylethanamine |
| SMILES | COc1cccc(-n2ncc3c(/N=N/Cc4ccc(OCCN(C)C)cc4)ncnc32)c1 |
| InChI | InChI=1S/C23H25N7O2/c1-29(2)11-12-32-19-9-7-17(8-10-19)14-26-28-22-21-15-27-30(23(21)25-16-24-22)18-5-4-6-20(13-18)31-3/h4-10,13,15-16H,11-12,14H2,1-3H3/b28-26+ |
| InChIKey | SKUPHTXFIQUENB-BYCLXTJYSA-N |
| XLogP | 4.05 |
| TPSA | 90.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|