C12H16 — CID 91574943
1,2,3,4,5,5a-hexahydroheptalene (PubChem CID 91574943) has the molecular formula C12H16 and a molecular weight of 160.26 g/mol. Its IUPAC name is 1,2,3,4,5,5a-hexahydroheptalene.
| Compound Name | 1,2,3,4,5,5a-hexahydroheptalene |
|---|---|
| PubChem CID | 91574943 |
| Molecular Formula | C12H16 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | 1,2,3,4,5,5a-hexahydroheptalene |
| SMILES | C1=CC=C2CCCCCC2C=C1 |
| InChI | InChI=1S/C12H16/c1-3-7-11-9-5-2-6-10-12(11)8-4-1/h1,3-4,7-8,11H,2,5-6,9-10H2 |
| InChIKey | MIMKYBGWXUAPDD-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |