About 3-methylsulfanylpropyl 4-ethyloctanoate
3-methylsulfanylpropyl 4-ethyloctanoate (PubChem CID 91575014) has the molecular formula C14H28O2S
and a molecular weight of 260.44 g/mol. Its IUPAC name is 3-methylsulfanylpropyl 4-ethyloctanoate.
Molecular Properties
| Compound Name | 3-methylsulfanylpropyl 4-ethyloctanoate |
| PubChem CID | 91575014 |
| Molecular Formula | C14H28O2S |
| Molecular Weight | 260.44 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | 3-methylsulfanylpropyl 4-ethyloctanoate |
| SMILES | CCCCC(CC)CCC(=O)OCCCSC |
| InChI | InChI=1S/C14H28O2S/c1-4-6-8-13(5-2)9-10-14(15)16-11-7-12-17-3/h13H,4-12H2,1-3H3 |
| InChIKey | FNCYWXDLDPQRFK-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.44 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-methylsulfanylpropyl 4-ethyloctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylsulfanylpropyl 4-ethyloctanoate?
The IUPAC name of 3-methylsulfanylpropyl 4-ethyloctanoate (CID 91575014) is 3-methylsulfanylpropyl 4-ethyloctanoate.
What is the SMILES notation for 3-methylsulfanylpropyl 4-ethyloctanoate?
The canonical SMILES for 3-methylsulfanylpropyl 4-ethyloctanoate is CCCCC(CC)CCC(=O)OCCCSC.
What is the InChIKey of 3-methylsulfanylpropyl 4-ethyloctanoate?
The InChIKey is FNCYWXDLDPQRFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O2S/c1-4-6-8-13(5-2)9-10-14(15)16-11-7-12-17-3/h13H,4-12H2,1-3H3.
What are the key properties of 3-methylsulfanylpropyl 4-ethyloctanoate?
3-methylsulfanylpropyl 4-ethyloctanoate has a molecular weight of 260.44 g/mol, XLogP of 4.28, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylsulfanylpropyl 4-ethyloctanoate is sourced from PubChem (CID 91575014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).