C14H26N2O3 — CID 91575072
4-ethenyl-4-(hydroxymethyl)-N,N,N',N'-tetramethylheptanediamide (PubChem CID 91575072) has the molecular formula C14H26N2O3 and a molecular weight of 270.37 g/mol. Its IUPAC name is 4-ethenyl-4-(hydroxymethyl)-N,N,N',N'-tetramethylheptanediamide.
| Compound Name | 4-ethenyl-4-(hydroxymethyl)-N,N,N',N'-tetramethylheptanediamide |
|---|---|
| PubChem CID | 91575072 |
| Molecular Formula | C14H26N2O3 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | 4-ethenyl-4-(hydroxymethyl)-N,N,N',N'-tetramethylheptanediamide |
| SMILES | C=CC(CO)(CCC(=O)N(C)C)CCC(=O)N(C)C |
| InChI | InChI=1S/C14H26N2O3/c1-6-14(11-17,9-7-12(18)15(2)3)10-8-13(19)16(4)5/h6,17H,1,7-11H2,2-5H3 |
| InChIKey | WOVKQKXLWGPZGM-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|