C20H36O14S — CID 91575226
S-[2-[2-[2-[(2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-3-[(2R,3S,4S,5S)-3,4,5-trihydroxy-2-(hydroxymethyl)oxan-4-yl]oxan-2-yl]oxyethoxy]ethoxy]ethyl] ethanethioate (PubChem CID 91575226) has the molecular formula C20H36O14S and a molecular weight of 532.56 g/mol. Its IUPAC name is S-[2-[2-[2-[(2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-3-[(2R,3S,4S,5S)-3,4,5-trihydroxy-2-(hydroxymethyl)oxan-4-yl]oxan-2-yl]oxyethoxy]ethoxy]ethyl] ethanethioate.
| Compound Name | S-[2-[2-[2-[(2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-3-[(2R,3S,4S,5S)-3,4,5-trihydroxy-2-(hydroxymethyl)oxan-4-yl]oxan-2-yl]oxyethoxy]ethoxy]ethyl] ethanethioate |
|---|---|
| PubChem CID | 91575226 |
| Molecular Formula | C20H36O14S |
| Molecular Weight | 532.56 g/mol |
| Exact Mass | 532.18 |
| IUPAC Name | S-[2-[2-[2-[(2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-3-[(2R,3S,4S,5S)-3,4,5-trihydroxy-2-(hydroxymethyl)oxan-4-yl]oxan-2-yl]oxyethoxy]ethoxy]ethyl] ethanethioate |
| SMILES | CC(=O)SCCOCCOCCO[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@]1(O)[C@]1(O)[C@@H](O)CO[C@H](CO)[C@@H]1O |
| InChI | InChI=1S/C20H36O14S/c1-11(23)35-7-6-31-3-2-30-4-5-32-18-20(29,17(27)15(25)12(8-21)34-18)19(28)14(24)10-33-13(9-22)16(19)26/h12-18,21-22,24-29H,2-10H2,1H3/t12-,13-,14+,15+,16+,17+,18+,19+,20-/m1/s1 |
| InChIKey | QVAUYINSTGYXMR-XDZORCOVSA-N |
| XLogP | -4.67 |
| TPSA | 225.06 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.56 |
| LogP ≤ 5 | -4.67 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|