C10H10Cl2O2 — CID 91575611
3-(2,6-dichlorophenyl)propyl formate (PubChem CID 91575611) has the molecular formula C10H10Cl2O2 and a molecular weight of 233.09 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)propyl formate.
| Compound Name | 3-(2,6-dichlorophenyl)propyl formate |
|---|---|
| PubChem CID | 91575611 |
| Molecular Formula | C10H10Cl2O2 |
| Molecular Weight | 233.09 g/mol |
| Exact Mass | 232.01 |
| IUPAC Name | 3-(2,6-dichlorophenyl)propyl formate |
| SMILES | O=COCCCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C10H10Cl2O2/c11-9-4-1-5-10(12)8(9)3-2-6-14-7-13/h1,4-5,7H,2-3,6H2 |
| InChIKey | HMOUUULZBQBGAW-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.09 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|