About N-[amino-[1-(2,4-dichlorophenyl)-5-phenylpyrazol-3-yl]methyl]-4-fluorobenzenesulfonamide
N-[amino-[1-(2,4-dichlorophenyl)-5-phenylpyrazol-3-yl]methyl]-4-fluorobenzenesulfonamide (PubChem CID 91575687) has the molecular formula C22H17Cl2FN4O2S
and a molecular weight of 491.38 g/mol. Its IUPAC name is N-[amino-[1-(2,4-dichlorophenyl)-5-phenylpyrazol-3-yl]methyl]-4-fluorobenzenesulfonamide.
Molecular Properties
| Compound Name | N-[amino-[1-(2,4-dichlorophenyl)-5-phenylpyrazol-3-yl]methyl]-4-fluorobenzenesulfonamide |
| PubChem CID | 91575687 |
| Molecular Formula | C22H17Cl2FN4O2S |
| Molecular Weight | 491.38 g/mol |
| Exact Mass | 490.04 |
| IUPAC Name | N-[amino-[1-(2,4-dichlorophenyl)-5-phenylpyrazol-3-yl]methyl]-4-fluorobenzenesulfonamide |
| SMILES | NC(NS(=O)(=O)c1ccc(F)cc1)c1cc(-c2ccccc2)n(-c2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C22H17Cl2FN4O2S/c23-15-6-11-20(18(24)12-15)29-21(14-4-2-1-3-5-14)13-19(27-29)22(26)28-32(30,31)17-9-7-16(25)8-10-17/h1-13,22,28H,26H2 |
| InChIKey | KZJBTKUUMKIXIX-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 491.38 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-[amino-[1-(2,4-dichlorophenyl)-5-phenylpyrazol-3-yl]methyl]-4-fluorobenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[amino-[1-(2,4-dichlorophenyl)-5-phenylpyrazol-3-yl]methyl]-4-fluorobenzenesulfonamide?
The IUPAC name of N-[amino-[1-(2,4-dichlorophenyl)-5-phenylpyrazol-3-yl]methyl]-4-fluorobenzenesulfonamide (CID 91575687) is N-[amino-[1-(2,4-dichlorophenyl)-5-phenylpyrazol-3-yl]methyl]-4-fluorobenzenesulfonamide.
What is the SMILES notation for N-[amino-[1-(2,4-dichlorophenyl)-5-phenylpyrazol-3-yl]methyl]-4-fluorobenzenesulfonamide?
The canonical SMILES for N-[amino-[1-(2,4-dichlorophenyl)-5-phenylpyrazol-3-yl]methyl]-4-fluorobenzenesulfonamide is NC(NS(=O)(=O)c1ccc(F)cc1)c1cc(-c2ccccc2)n(-c2ccc(Cl)cc2Cl)n1.
What is the InChIKey of N-[amino-[1-(2,4-dichlorophenyl)-5-phenylpyrazol-3-yl]methyl]-4-fluorobenzenesulfonamide?
The InChIKey is KZJBTKUUMKIXIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17Cl2FN4O2S/c23-15-6-11-20(18(24)12-15)29-21(14-4-2-1-3-5-14)13-19(27-29)22(26)28-32(30,31)17-9-7-16(25)8-10-17/h1-13,22,28H,26H2.
What are the key properties of N-[amino-[1-(2,4-dichlorophenyl)-5-phenylpyrazol-3-yl]methyl]-4-fluorobenzenesulfonamide?
N-[amino-[1-(2,4-dichlorophenyl)-5-phenylpyrazol-3-yl]methyl]-4-fluorobenzenesulfonamide has a molecular weight of 491.38 g/mol, XLogP of 4.92, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[amino-[1-(2,4-dichlorophenyl)-5-phenylpyrazol-3-yl]methyl]-4-fluorobenzenesulfonamide is sourced from PubChem (CID 91575687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).