C9H10O3 — CID 91575752
4-methylbicyclo[4.2.0]octa-1(6),2,4-triene-2,3,5-triol (PubChem CID 91575752) has the molecular formula C9H10O3 and a molecular weight of 166.18 g/mol. Its IUPAC name is 4-methylbicyclo[4.2.0]octa-1(6),2,4-triene-2,3,5-triol.
| Compound Name | 4-methylbicyclo[4.2.0]octa-1(6),2,4-triene-2,3,5-triol |
|---|---|
| PubChem CID | 91575752 |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | 4-methylbicyclo[4.2.0]octa-1(6),2,4-triene-2,3,5-triol |
| SMILES | Cc1c(O)c(O)c2c(c1O)CC2 |
| InChI | InChI=1S/C9H10O3/c1-4-7(10)5-2-3-6(5)9(12)8(4)11/h10-12H,2-3H2,1H3 |
| InChIKey | UTZKBYBXKPQWAT-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|