C15H23ClN4O5S2 — CID 91576307
6-chloro-3-(1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-yl)-1,1-dioxo-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-7-sulfonamide (PubChem CID 91576307) has the molecular formula C15H23ClN4O5S2 and a molecular weight of 438.96 g/mol. Its IUPAC name is 6-chloro-3-(1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-yl)-1,1-dioxo-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-7-sulfonamide.
| Compound Name | 6-chloro-3-(1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-yl)-1,1-dioxo-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-7-sulfonamide |
|---|---|
| PubChem CID | 91576307 |
| Molecular Formula | C15H23ClN4O5S2 |
| Molecular Weight | 438.96 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | 6-chloro-3-(1-hydroxy-2,2,5,5-tetramethylpyrrolidin-3-yl)-1,1-dioxo-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-7-sulfonamide |
| SMILES | CC1(C)CC(C2Nc3cc(Cl)c(S(N)(=O)=O)cc3S(=O)(=O)N2)C(C)(C)N1O |
| InChI | InChI=1S/C15H23ClN4O5S2/c1-14(2)7-8(15(3,4)20(14)21)13-18-10-5-9(16)11(26(17,22)23)6-12(10)27(24,25)19-13/h5-6,8,13,18-19,21H,7H2,1-4H3,(H2,17,22,23) |
| InChIKey | RGUYFAGAVDDROZ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 141.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.96 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |