About penta-1,4-diene-1,3-dione
penta-1,4-diene-1,3-dione (PubChem CID 91576490) has the molecular formula C5H4O2
and a molecular weight of 96.08 g/mol. Its IUPAC name is penta-1,4-diene-1,3-dione.
Molecular Properties
| Compound Name | penta-1,4-diene-1,3-dione |
| PubChem CID | 91576490 |
| Molecular Formula | C5H4O2 |
| Molecular Weight | 96.08 g/mol |
| Exact Mass | 96.02 |
| IUPAC Name | penta-1,4-diene-1,3-dione |
| SMILES | C=CC(=O)C=C=O |
| InChI | InChI=1S/C5H4O2/c1-2-5(7)3-4-6/h2-3H,1H2 |
| InChIKey | HKZHDGXVXHZVBR-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 96.08 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze penta-1,4-diene-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of penta-1,4-diene-1,3-dione?
The IUPAC name of penta-1,4-diene-1,3-dione (CID 91576490) is penta-1,4-diene-1,3-dione.
What is the SMILES notation for penta-1,4-diene-1,3-dione?
The canonical SMILES for penta-1,4-diene-1,3-dione is C=CC(=O)C=C=O.
What is the InChIKey of penta-1,4-diene-1,3-dione?
The InChIKey is HKZHDGXVXHZVBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4O2/c1-2-5(7)3-4-6/h2-3H,1H2.
What are the key properties of penta-1,4-diene-1,3-dione?
penta-1,4-diene-1,3-dione has a molecular weight of 96.08 g/mol, XLogP of 0.13, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for penta-1,4-diene-1,3-dione is sourced from PubChem (CID 91576490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).