C29H31N4O2S+ — CID 91576594
(2R)-1-[2-(1H-benzimidazol-2-ylsulfanyl)acetyl]-N-(1,2-diphenylethyl)-2-methylpyrrolidin-1-ium-1-carboxamide (PubChem CID 91576594) has the molecular formula C29H31N4O2S+ and a molecular weight of 499.66 g/mol. Its IUPAC name is (2R)-1-[2-(1H-benzimidazol-2-ylsulfanyl)acetyl]-N-(1,2-diphenylethyl)-2-methylpyrrolidin-1-ium-1-carboxamide.
| Compound Name | (2R)-1-[2-(1H-benzimidazol-2-ylsulfanyl)acetyl]-N-(1,2-diphenylethyl)-2-methylpyrrolidin-1-ium-1-carboxamide |
|---|---|
| PubChem CID | 91576594 |
| Molecular Formula | C29H31N4O2S+ |
| Molecular Weight | 499.66 g/mol |
| Exact Mass | 499.22 |
| IUPAC Name | (2R)-1-[2-(1H-benzimidazol-2-ylsulfanyl)acetyl]-N-(1,2-diphenylethyl)-2-methylpyrrolidin-1-ium-1-carboxamide |
| SMILES | C[C@@H]1CCC[N+]1(C(=O)CSc1nc2ccccc2[nH]1)C(=O)NC(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H30N4O2S/c1-21-11-10-18-33(21,27(34)20-36-28-30-24-16-8-9-17-25(24)31-28)29(35)32-26(23-14-6-3-7-15-23)19-22-12-4-2-5-13-22/h2-9,12-17,21,26H,10-11,18-20H2,1H3,(H-,30,31,32,35)/p+1/t21-,26?,33?/m1/s1 |
| InChIKey | ZXEGIAUTAKMEAX-HCEQOSGLSA-O |
| XLogP | 5.87 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.66 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|