About CID 91576598
CID 91576598 (PubChem CID 91576598) has the molecular formula C29H30ClN3O
and a molecular weight of 472.03 g/mol.
Molecular Properties
| Compound Name | CID 91576598 |
| PubChem CID | 91576598 |
| Molecular Formula | C29H30ClN3O |
| Molecular Weight | 472.03 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | — |
| SMILES | CCc1cc(Cl)cc(-c2ccc3c(c2)C2(N=C(N)N(C)O2)C2(CCc4ccccc4CC2)C3)c1 |
| InChI | InChI=1S/C29H30ClN3O/c1-3-19-14-24(16-25(30)15-19)22-8-9-23-18-28(12-10-20-6-4-5-7-21(20)11-13-28)29(26(23)17-22)32-27(31)33(2)34-29/h4-9,14-17H,3,10-13,18H2,1-2H3,(H2,31,32) |
| InChIKey | TXBSZZNJZICAED-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 472.03 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 91576598 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 91576598?
The IUPAC name of CID 91576598 (CID 91576598) is not available.
What is the SMILES notation for CID 91576598?
The canonical SMILES for CID 91576598 is CCc1cc(Cl)cc(-c2ccc3c(c2)C2(N=C(N)N(C)O2)C2(CCc4ccccc4CC2)C3)c1.
What is the InChIKey of CID 91576598?
The InChIKey is TXBSZZNJZICAED-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H30ClN3O/c1-3-19-14-24(16-25(30)15-19)22-8-9-23-18-28(12-10-20-6-4-5-7-21(20)11-13-28)29(26(23)17-22)32-27(31)33(2)34-29/h4-9,14-17H,3,10-13,18H2,1-2H3,(H2,31,32).
What are the key properties of CID 91576598?
CID 91576598 has a molecular weight of 472.03 g/mol, XLogP of 6.04, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 91576598 is sourced from PubChem (CID 91576598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).