C23H32F2N4O2S — CID 91577520
N-[5-[1-(butylamino)ethyl]-4-methyl-1,3-thiazol-2-yl]-2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanamide (PubChem CID 91577520) has the molecular formula C23H32F2N4O2S and a molecular weight of 466.60 g/mol. Its IUPAC name is N-[5-[1-(butylamino)ethyl]-4-methyl-1,3-thiazol-2-yl]-2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanamide.
| Compound Name | N-[5-[1-(butylamino)ethyl]-4-methyl-1,3-thiazol-2-yl]-2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanamide |
|---|---|
| PubChem CID | 91577520 |
| Molecular Formula | C23H32F2N4O2S |
| Molecular Weight | 466.60 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | N-[5-[1-(butylamino)ethyl]-4-methyl-1,3-thiazol-2-yl]-2-[[2-(3,5-difluorophenyl)acetyl]amino]pentanamide |
| SMILES | CCCCNC(C)c1sc(NC(=O)C(CCC)NC(=O)Cc2cc(F)cc(F)c2)nc1C |
| InChI | InChI=1S/C23H32F2N4O2S/c1-5-7-9-26-14(3)21-15(4)27-23(32-21)29-22(31)19(8-6-2)28-20(30)12-16-10-17(24)13-18(25)11-16/h10-11,13-14,19,26H,5-9,12H2,1-4H3,(H,28,30)(H,27,29,31) |
| InChIKey | SSZBTLPIKPHKPX-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.60 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|