C22H33N3O2 — CID 91577551
N,N-dibutyl-2-(3-tert-butyl-2-oxo-1H-1,6-naphthyridin-4-yl)acetamide (PubChem CID 91577551) has the molecular formula C22H33N3O2 and a molecular weight of 371.53 g/mol. Its IUPAC name is N,N-dibutyl-2-(3-tert-butyl-2-oxo-1H-1,6-naphthyridin-4-yl)acetamide.
| Compound Name | N,N-dibutyl-2-(3-tert-butyl-2-oxo-1H-1,6-naphthyridin-4-yl)acetamide |
|---|---|
| PubChem CID | 91577551 |
| Molecular Formula | C22H33N3O2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | N,N-dibutyl-2-(3-tert-butyl-2-oxo-1H-1,6-naphthyridin-4-yl)acetamide |
| SMILES | CCCCN(CCCC)C(=O)Cc1c(C(C)(C)C)c(=O)[nH]c2ccncc12 |
| InChI | InChI=1S/C22H33N3O2/c1-6-8-12-25(13-9-7-2)19(26)14-16-17-15-23-11-10-18(17)24-21(27)20(16)22(3,4)5/h10-11,15H,6-9,12-14H2,1-5H3,(H,24,27) |
| InChIKey | BLDSGYRHNDIUEF-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |