C15H30N6O3 — CID 91577581
1-[[4-amino-6-[bis(1-hydroxybutyl)amino]-1,3,5-triazin-2-yl]amino]butan-1-ol (PubChem CID 91577581) has the molecular formula C15H30N6O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is 1-[[4-amino-6-[bis(1-hydroxybutyl)amino]-1,3,5-triazin-2-yl]amino]butan-1-ol.
| Compound Name | 1-[[4-amino-6-[bis(1-hydroxybutyl)amino]-1,3,5-triazin-2-yl]amino]butan-1-ol |
|---|---|
| PubChem CID | 91577581 |
| Molecular Formula | C15H30N6O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | 1-[[4-amino-6-[bis(1-hydroxybutyl)amino]-1,3,5-triazin-2-yl]amino]butan-1-ol |
| SMILES | CCCC(O)Nc1nc(N)nc(N(C(O)CCC)C(O)CCC)n1 |
| InChI | InChI=1S/C15H30N6O3/c1-4-7-10(22)17-14-18-13(16)19-15(20-14)21(11(23)8-5-2)12(24)9-6-3/h10-12,22-24H,4-9H2,1-3H3,(H3,16,17,18,19,20) |
| InChIKey | IIJCDWQCOGRDNN-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 140.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|