About N-[4-(2,5-dihydroxypyrrol-1-yl)sulfonylphenyl]-2-methyl-N-methylsulfonylprop-2-enamide
N-[4-(2,5-dihydroxypyrrol-1-yl)sulfonylphenyl]-2-methyl-N-methylsulfonylprop-2-enamide (PubChem CID 91577606) has the molecular formula C15H16N2O7S2
and a molecular weight of 400.43 g/mol. Its IUPAC name is N-[4-(2,5-dihydroxypyrrol-1-yl)sulfonylphenyl]-2-methyl-N-methylsulfonylprop-2-enamide.
Molecular Properties
| Compound Name | N-[4-(2,5-dihydroxypyrrol-1-yl)sulfonylphenyl]-2-methyl-N-methylsulfonylprop-2-enamide |
| PubChem CID | 91577606 |
| Molecular Formula | C15H16N2O7S2 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | N-[4-(2,5-dihydroxypyrrol-1-yl)sulfonylphenyl]-2-methyl-N-methylsulfonylprop-2-enamide |
| SMILES | C=C(C)C(=O)N(c1ccc(S(=O)(=O)n2c(O)ccc2O)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C15H16N2O7S2/c1-10(2)15(20)16(25(3,21)22)11-4-6-12(7-5-11)26(23,24)17-13(18)8-9-14(17)19/h4-9,18-19H,1H2,2-3H3 |
| InChIKey | WJGFDXJWEBDJJC-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 133.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(2,5-dihydroxypyrrol-1-yl)sulfonylphenyl]-2-methyl-N-methylsulfonylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(2,5-dihydroxypyrrol-1-yl)sulfonylphenyl]-2-methyl-N-methylsulfonylprop-2-enamide?
The IUPAC name of N-[4-(2,5-dihydroxypyrrol-1-yl)sulfonylphenyl]-2-methyl-N-methylsulfonylprop-2-enamide (CID 91577606) is N-[4-(2,5-dihydroxypyrrol-1-yl)sulfonylphenyl]-2-methyl-N-methylsulfonylprop-2-enamide.
What is the SMILES notation for N-[4-(2,5-dihydroxypyrrol-1-yl)sulfonylphenyl]-2-methyl-N-methylsulfonylprop-2-enamide?
The canonical SMILES for N-[4-(2,5-dihydroxypyrrol-1-yl)sulfonylphenyl]-2-methyl-N-methylsulfonylprop-2-enamide is C=C(C)C(=O)N(c1ccc(S(=O)(=O)n2c(O)ccc2O)cc1)S(C)(=O)=O.
What is the InChIKey of N-[4-(2,5-dihydroxypyrrol-1-yl)sulfonylphenyl]-2-methyl-N-methylsulfonylprop-2-enamide?
The InChIKey is WJGFDXJWEBDJJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2O7S2/c1-10(2)15(20)16(25(3,21)22)11-4-6-12(7-5-11)26(23,24)17-13(18)8-9-14(17)19/h4-9,18-19H,1H2,2-3H3.
What are the key properties of N-[4-(2,5-dihydroxypyrrol-1-yl)sulfonylphenyl]-2-methyl-N-methylsulfonylprop-2-enamide?
N-[4-(2,5-dihydroxypyrrol-1-yl)sulfonylphenyl]-2-methyl-N-methylsulfonylprop-2-enamide has a molecular weight of 400.43 g/mol, XLogP of 1.00, 5 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(2,5-dihydroxypyrrol-1-yl)sulfonylphenyl]-2-methyl-N-methylsulfonylprop-2-enamide is sourced from PubChem (CID 91577606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).