About 2-(5'-methyl-1'-propylspiro[cyclohexane-1,3'-indol-1-ium]-2'-yl)-N-phenylethanimine
2-(5'-methyl-1'-propylspiro[cyclohexane-1,3'-indol-1-ium]-2'-yl)-N-phenylethanimine (PubChem CID 91577871) has the molecular formula C25H31N2+
and a molecular weight of 359.54 g/mol. Its IUPAC name is 2-(5'-methyl-1'-propylspiro[cyclohexane-1,3'-indol-1-ium]-2'-yl)-N-phenylethanimine.
Molecular Properties
| Compound Name | 2-(5'-methyl-1'-propylspiro[cyclohexane-1,3'-indol-1-ium]-2'-yl)-N-phenylethanimine |
| PubChem CID | 91577871 |
| Molecular Formula | C25H31N2+ |
| Molecular Weight | 359.54 g/mol |
| Exact Mass | 359.25 |
| IUPAC Name | 2-(5'-methyl-1'-propylspiro[cyclohexane-1,3'-indol-1-ium]-2'-yl)-N-phenylethanimine |
| SMILES | CCC[N+]1=C(C/C=N/c2ccccc2)C2(CCCCC2)c2cc(C)ccc21 |
| InChI | InChI=1S/C25H31N2/c1-3-18-27-23-13-12-20(2)19-22(23)25(15-8-5-9-16-25)24(27)14-17-26-21-10-6-4-7-11-21/h4,6-7,10-13,17,19H,3,5,8-9,14-16,18H2,1-2H3/q+1/b26-17+ |
| InChIKey | QJSPOQFDBDDJDJ-YZSQISJMSA-N |
| XLogP | 6.50 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.54 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(5'-methyl-1'-propylspiro[cyclohexane-1,3'-indol-1-ium]-2'-yl)-N-phenylethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5'-methyl-1'-propylspiro[cyclohexane-1,3'-indol-1-ium]-2'-yl)-N-phenylethanimine?
The IUPAC name of 2-(5'-methyl-1'-propylspiro[cyclohexane-1,3'-indol-1-ium]-2'-yl)-N-phenylethanimine (CID 91577871) is 2-(5'-methyl-1'-propylspiro[cyclohexane-1,3'-indol-1-ium]-2'-yl)-N-phenylethanimine.
What is the SMILES notation for 2-(5'-methyl-1'-propylspiro[cyclohexane-1,3'-indol-1-ium]-2'-yl)-N-phenylethanimine?
The canonical SMILES for 2-(5'-methyl-1'-propylspiro[cyclohexane-1,3'-indol-1-ium]-2'-yl)-N-phenylethanimine is CCC[N+]1=C(C/C=N/c2ccccc2)C2(CCCCC2)c2cc(C)ccc21.
What is the InChIKey of 2-(5'-methyl-1'-propylspiro[cyclohexane-1,3'-indol-1-ium]-2'-yl)-N-phenylethanimine?
The InChIKey is QJSPOQFDBDDJDJ-YZSQISJMSA-N. The full InChI is InChI=1S/C25H31N2/c1-3-18-27-23-13-12-20(2)19-22(23)25(15-8-5-9-16-25)24(27)14-17-26-21-10-6-4-7-11-21/h4,6-7,10-13,17,19H,3,5,8-9,14-16,18H2,1-2H3/q+1/b26-17+.
What are the key properties of 2-(5'-methyl-1'-propylspiro[cyclohexane-1,3'-indol-1-ium]-2'-yl)-N-phenylethanimine?
2-(5'-methyl-1'-propylspiro[cyclohexane-1,3'-indol-1-ium]-2'-yl)-N-phenylethanimine has a molecular weight of 359.54 g/mol, XLogP of 6.50, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5'-methyl-1'-propylspiro[cyclohexane-1,3'-indol-1-ium]-2'-yl)-N-phenylethanimine is sourced from PubChem (CID 91577871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).