C10H16O3 — CID 91578160
5-methoxy-2,2,6-trimethylcyclohexane-1,4-dione (PubChem CID 91578160) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is 5-methoxy-2,2,6-trimethylcyclohexane-1,4-dione.
| Compound Name | 5-methoxy-2,2,6-trimethylcyclohexane-1,4-dione |
|---|---|
| PubChem CID | 91578160 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | 5-methoxy-2,2,6-trimethylcyclohexane-1,4-dione |
| SMILES | COC1C(=O)CC(C)(C)C(=O)C1C |
| InChI | InChI=1S/C10H16O3/c1-6-8(13-4)7(11)5-10(2,3)9(6)12/h6,8H,5H2,1-4H3 |
| InChIKey | MBTRLCLZSUGNOL-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |