C45H31F6N3O5S2 — CID 91578378
2-[4-[2-[4-[3-[3-(1,3-benzothiazol-2-yl)-4-methylphenyl]-2-cyanophenoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]-6-methylbenzonitrile;methanesulfonic acid (PubChem CID 91578378) has the molecular formula C45H31F6N3O5S2 and a molecular weight of 871.88 g/mol. Its IUPAC name is 2-[4-[2-[4-[3-[3-(1,3-benzothiazol-2-yl)-4-methylphenyl]-2-cyanophenoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]-6-methylbenzonitrile;methanesulfonic acid.
| Compound Name | 2-[4-[2-[4-[3-[3-(1,3-benzothiazol-2-yl)-4-methylphenyl]-2-cyanophenoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]-6-methylbenzonitrile;methanesulfonic acid |
|---|---|
| PubChem CID | 91578378 |
| Molecular Formula | C45H31F6N3O5S2 |
| Molecular Weight | 871.88 g/mol |
| Exact Mass | 871.16 |
| IUPAC Name | 2-[4-[2-[4-[3-[3-(1,3-benzothiazol-2-yl)-4-methylphenyl]-2-cyanophenoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]-6-methylbenzonitrile;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.Cc1ccc(-c2cccc(Oc3ccc(C(c4ccc(Oc5cccc(C)c5C#N)cc4)(C(F)(F)F)C(F)(F)F)cc3)c2C#N)cc1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C44H27F6N3O2S.CH4O3S/c1-26-7-5-10-38(35(26)24-51)54-31-19-15-29(16-20-31)42(43(45,46)47,44(48,49)50)30-17-21-32(22-18-30)55-39-11-6-8-33(36(39)25-52)28-14-13-27(2)34(23-28)41-53-37-9-3-4-12-40(37)56-41;1-5(2,3)4/h3-23H,1-2H3;1H3,(H,2,3,4) |
| InChIKey | QZMGOHQULLMEIE-UHFFFAOYSA-N |
| XLogP | 12.49 |
| TPSA | 133.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.88 |
| LogP ≤ 5 | 12.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|