C18H25N3OS — CID 91578417
6-thia-3,15-diazatricyclo[14.4.0.05,7]icosa-1(20),8,16,18-tetraene-5-carboxamide (PubChem CID 91578417) has the molecular formula C18H25N3OS and a molecular weight of 331.49 g/mol. Its IUPAC name is 6-thia-3,15-diazatricyclo[14.4.0.05,7]icosa-1(20),8,16,18-tetraene-5-carboxamide.
| Compound Name | 6-thia-3,15-diazatricyclo[14.4.0.05,7]icosa-1(20),8,16,18-tetraene-5-carboxamide |
|---|---|
| PubChem CID | 91578417 |
| Molecular Formula | C18H25N3OS |
| Molecular Weight | 331.49 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 6-thia-3,15-diazatricyclo[14.4.0.05,7]icosa-1(20),8,16,18-tetraene-5-carboxamide |
| SMILES | NC(=O)C12CNCc3ccccc3NCCCCCC=CC1S2 |
| InChI | InChI=1S/C18H25N3OS/c19-17(22)18-13-20-12-14-8-5-6-9-15(14)21-11-7-3-1-2-4-10-16(18)23-18/h4-6,8-10,16,20-21H,1-3,7,11-13H2,(H2,19,22) |
| InChIKey | UQXUSJKSIMEOGN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.49 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|