C22H24F3N7O2 — CID 91578502
5-[amino-[2-(1,5-dimethylpyrazol-4-yl)-2-iminoethyl]amino]-N-[4-methoxy-3-(trifluoromethyl)phenyl]-6-methylpyridine-3-carboxamide (PubChem CID 91578502) has the molecular formula C22H24F3N7O2 and a molecular weight of 475.48 g/mol. Its IUPAC name is 5-[amino-[2-(1,5-dimethylpyrazol-4-yl)-2-iminoethyl]amino]-N-[4-methoxy-3-(trifluoromethyl)phenyl]-6-methylpyridine-3-carboxamide.
| Compound Name | 5-[amino-[2-(1,5-dimethylpyrazol-4-yl)-2-iminoethyl]amino]-N-[4-methoxy-3-(trifluoromethyl)phenyl]-6-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 91578502 |
| Molecular Formula | C22H24F3N7O2 |
| Molecular Weight | 475.48 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | 5-[amino-[2-(1,5-dimethylpyrazol-4-yl)-2-iminoethyl]amino]-N-[4-methoxy-3-(trifluoromethyl)phenyl]-6-methylpyridine-3-carboxamide |
| SMILES | [H]/N=C(/CN(N)c1cc(C(=O)Nc2ccc(OC)c(C(F)(F)F)c2)cnc1C)c1cnn(C)c1C |
| InChI | InChI=1S/C22H24F3N7O2/c1-12-19(32(27)11-18(26)16-10-29-31(3)13(16)2)7-14(9-28-12)21(33)30-15-5-6-20(34-4)17(8-15)22(23,24)25/h5-10,26H,11,27H2,1-4H3,(H,30,33)/b26-18- |
| InChIKey | NWKFOOWZKQRSIC-ITYLOYPMSA-N |
| XLogP | 3.46 |
| TPSA | 122.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.48 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|