C17H34 — CID 91578929
3,3,5,5,9-pentamethyl-7-methylideneundecane (PubChem CID 91578929) has the molecular formula C17H34 and a molecular weight of 238.46 g/mol. Its IUPAC name is 3,3,5,5,9-pentamethyl-7-methylideneundecane.
| Compound Name | 3,3,5,5,9-pentamethyl-7-methylideneundecane |
|---|---|
| PubChem CID | 91578929 |
| Molecular Formula | C17H34 |
| Molecular Weight | 238.46 g/mol |
| Exact Mass | 238.27 |
| IUPAC Name | 3,3,5,5,9-pentamethyl-7-methylideneundecane |
| SMILES | C=C(CC(C)CC)CC(C)(C)CC(C)(C)CC |
| InChI | InChI=1S/C17H34/c1-9-14(3)11-15(4)12-17(7,8)13-16(5,6)10-2/h14H,4,9-13H2,1-3,5-8H3 |
| InChIKey | AUEHJYPPSBJFPP-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.46 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|