C7H2Cl5N7O3 — CID 91578986
[4-nitro-5-(1,1,2,2,2-pentachloroethyl)triazol-1-yl]-(triazol-1-yl)methanone (PubChem CID 91578986) has the molecular formula C7H2Cl5N7O3 and a molecular weight of 409.40 g/mol. Its IUPAC name is [4-nitro-5-(1,1,2,2,2-pentachloroethyl)triazol-1-yl]-(triazol-1-yl)methanone.
| Compound Name | [4-nitro-5-(1,1,2,2,2-pentachloroethyl)triazol-1-yl]-(triazol-1-yl)methanone |
|---|---|
| PubChem CID | 91578986 |
| Molecular Formula | C7H2Cl5N7O3 |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 406.87 |
| IUPAC Name | [4-nitro-5-(1,1,2,2,2-pentachloroethyl)triazol-1-yl]-(triazol-1-yl)methanone |
| SMILES | O=C(n1ccnn1)n1nnc([N+](=O)[O-])c1C(Cl)(Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C7H2Cl5N7O3/c8-6(9,7(10,11)12)3-4(19(21)22)14-16-18(3)5(20)17-2-1-13-15-17/h1-2H |
| InChIKey | YSMFOKNKDDQDPY-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 121.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|