C39H43NO2 — CID 91579694
15,17,21,23,29,35-hexamethyl-11,36-dioxa-4-azatricyclo[30.3.1.04,9]hexatriaconta-1(35),2,5,7,9,13,15,17,19,21,23,25,27,29,31,33-hexadecaene (PubChem CID 91579694) has the molecular formula C39H43NO2 and a molecular weight of 557.78 g/mol. Its IUPAC name is 15,17,21,23,29,35-hexamethyl-11,36-dioxa-4-azatricyclo[30.3.1.04,9]hexatriaconta-1(35),2,5,7,9,13,15,17,19,21,23,25,27,29,31,33-hexadecaene.
| Compound Name | 15,17,21,23,29,35-hexamethyl-11,36-dioxa-4-azatricyclo[30.3.1.04,9]hexatriaconta-1(35),2,5,7,9,13,15,17,19,21,23,25,27,29,31,33-hexadecaene |
|---|---|
| PubChem CID | 91579694 |
| Molecular Formula | C39H43NO2 |
| Molecular Weight | 557.78 g/mol |
| Exact Mass | 557.33 |
| IUPAC Name | 15,17,21,23,29,35-hexamethyl-11,36-dioxa-4-azatricyclo[30.3.1.04,9]hexatriaconta-1(35),2,5,7,9,13,15,17,19,21,23,25,27,29,31,33-hexadecaene |
| SMILES | CC1=CC=C2C=CC(C)=C(C=CN3C=CC=CC3=COCC=CC(C)=CC(C)=CC=CC(C)=CC(C)=CC=CC=C1)O2 |
| InChI | InChI=1S/C39H43NO2/c1-31-14-8-7-9-15-32(2)28-33(3)16-12-17-34(4)29-35(5)18-13-27-41-30-37-19-10-11-25-40(37)26-24-39-36(6)21-23-38(42-39)22-20-31/h7-26,28-30H,27H2,1-6H3 |
| InChIKey | KJMVQAWSEYVHMK-UHFFFAOYSA-N |
| XLogP | 10.46 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.78 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |