C22H24FN3O2S — CID 91579920
1-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]-3-(3-fluorophenyl)-4-hydroxy-5-methylimidazole-2-thione (PubChem CID 91579920) has the molecular formula C22H24FN3O2S and a molecular weight of 413.52 g/mol. Its IUPAC name is 1-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]-3-(3-fluorophenyl)-4-hydroxy-5-methylimidazole-2-thione.
| Compound Name | 1-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]-3-(3-fluorophenyl)-4-hydroxy-5-methylimidazole-2-thione |
|---|---|
| PubChem CID | 91579920 |
| Molecular Formula | C22H24FN3O2S |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 1-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]-3-(3-fluorophenyl)-4-hydroxy-5-methylimidazole-2-thione |
| SMILES | Cc1c(O)n(-c2cccc(F)c2)c(=S)n1-c1ccc(N2C[C@@H](C)O[C@@H](C)C2)cc1 |
| InChI | InChI=1S/C22H24FN3O2S/c1-14-12-24(13-15(2)28-14)18-7-9-19(10-8-18)25-16(3)21(27)26(22(25)29)20-6-4-5-17(23)11-20/h4-11,14-15,27H,12-13H2,1-3H3/t14-,15+ |
| InChIKey | ZFIPWZDIZBQGIY-GASCZTMLSA-N |
| XLogP | 4.76 |
| TPSA | 42.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|