C11H14ClN3O2 — CID 91579953
2-(3-chloro-4-methylpiperazin-1-yl)pyridine-4-carboxylic acid (PubChem CID 91579953) has the molecular formula C11H14ClN3O2 and a molecular weight of 255.71 g/mol. Its IUPAC name is 2-(3-chloro-4-methylpiperazin-1-yl)pyridine-4-carboxylic acid.
| Compound Name | 2-(3-chloro-4-methylpiperazin-1-yl)pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 91579953 |
| Molecular Formula | C11H14ClN3O2 |
| Molecular Weight | 255.71 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 2-(3-chloro-4-methylpiperazin-1-yl)pyridine-4-carboxylic acid |
| SMILES | CN1CCN(c2cc(C(=O)O)ccn2)CC1Cl |
| InChI | InChI=1S/C11H14ClN3O2/c1-14-4-5-15(7-9(14)12)10-6-8(11(16)17)2-3-13-10/h2-3,6,9H,4-5,7H2,1H3,(H,16,17) |
| InChIKey | AAZGGSMNCZJLPY-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.71 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|