About benzo[k]fluoranthene
benzo[k]fluoranthene (PubChem CID 9158) has the molecular formula C20H12
and a molecular weight of 252.32 g/mol. Its IUPAC name is benzo[k]fluoranthene.
Molecular Properties
| Compound Name | benzo[k]fluoranthene |
| PubChem CID | 9158 |
| Molecular Formula | C20H12 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | benzo[k]fluoranthene |
| SMILES | c1ccc2cc3c(cc2c1)-c1cccc2cccc-3c12 |
| InChI | InChI=1S/C20H12/c1-2-6-15-12-19-17-10-4-8-13-7-3-9-16(20(13)17)18(19)11-14(15)5-1/h1-12H |
| InChIKey | HAXBIWFMXWRORI-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze benzo[k]fluoranthene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[k]fluoranthene?
The IUPAC name of benzo[k]fluoranthene (CID 9158) is benzo[k]fluoranthene.
What is the SMILES notation for benzo[k]fluoranthene?
The canonical SMILES for benzo[k]fluoranthene is c1ccc2cc3c(cc2c1)-c1cccc2cccc-3c12.
What is the InChIKey of benzo[k]fluoranthene?
The InChIKey is HAXBIWFMXWRORI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12/c1-2-6-15-12-19-17-10-4-8-13-7-3-9-16(20(13)17)18(19)11-14(15)5-1/h1-12H.
What are the key properties of benzo[k]fluoranthene?
benzo[k]fluoranthene has a molecular weight of 252.32 g/mol, XLogP of 5.64, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[k]fluoranthene is sourced from PubChem (CID 9158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).