About 3-(3-butylsulfanyl-1H-1,2,4-triazol-5-yl)pyridine
3-(3-butylsulfanyl-1H-1,2,4-triazol-5-yl)pyridine (PubChem CID 91580171) has the molecular formula C11H14N4S
and a molecular weight of 234.33 g/mol. Its IUPAC name is 3-(3-butylsulfanyl-1H-1,2,4-triazol-5-yl)pyridine.
Molecular Properties
| Compound Name | 3-(3-butylsulfanyl-1H-1,2,4-triazol-5-yl)pyridine |
| PubChem CID | 91580171 |
| Molecular Formula | C11H14N4S |
| Molecular Weight | 234.33 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 3-(3-butylsulfanyl-1H-1,2,4-triazol-5-yl)pyridine |
| SMILES | CCCCSc1n[nH]c(-c2cccnc2)n1 |
| InChI | InChI=1S/C11H14N4S/c1-2-3-7-16-11-13-10(14-15-11)9-5-4-6-12-8-9/h4-6,8H,2-3,7H2,1H3,(H,13,14,15) |
| InChIKey | FJMPOIDMLDOEJZ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-butylsulfanyl-1H-1,2,4-triazol-5-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-butylsulfanyl-1H-1,2,4-triazol-5-yl)pyridine?
The IUPAC name of 3-(3-butylsulfanyl-1H-1,2,4-triazol-5-yl)pyridine (CID 91580171) is 3-(3-butylsulfanyl-1H-1,2,4-triazol-5-yl)pyridine.
What is the SMILES notation for 3-(3-butylsulfanyl-1H-1,2,4-triazol-5-yl)pyridine?
The canonical SMILES for 3-(3-butylsulfanyl-1H-1,2,4-triazol-5-yl)pyridine is CCCCSc1n[nH]c(-c2cccnc2)n1.
What is the InChIKey of 3-(3-butylsulfanyl-1H-1,2,4-triazol-5-yl)pyridine?
The InChIKey is FJMPOIDMLDOEJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4S/c1-2-3-7-16-11-13-10(14-15-11)9-5-4-6-12-8-9/h4-6,8H,2-3,7H2,1H3,(H,13,14,15).
What are the key properties of 3-(3-butylsulfanyl-1H-1,2,4-triazol-5-yl)pyridine?
3-(3-butylsulfanyl-1H-1,2,4-triazol-5-yl)pyridine has a molecular weight of 234.33 g/mol, XLogP of 2.76, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-butylsulfanyl-1H-1,2,4-triazol-5-yl)pyridine is sourced from PubChem (CID 91580171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).