C11H17ClFNO2 — CID 91580238
2-chloro-4-fluoro-N-(2-methoxyethyl)-5-methylidenecyclohexane-1-carboxamide (PubChem CID 91580238) has the molecular formula C11H17ClFNO2 and a molecular weight of 249.71 g/mol. Its IUPAC name is 2-chloro-4-fluoro-N-(2-methoxyethyl)-5-methylidenecyclohexane-1-carboxamide.
| Compound Name | 2-chloro-4-fluoro-N-(2-methoxyethyl)-5-methylidenecyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 91580238 |
| Molecular Formula | C11H17ClFNO2 |
| Molecular Weight | 249.71 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 2-chloro-4-fluoro-N-(2-methoxyethyl)-5-methylidenecyclohexane-1-carboxamide |
| SMILES | C=C1CC(C(=O)NCCOC)C(Cl)CC1F |
| InChI | InChI=1S/C11H17ClFNO2/c1-7-5-8(9(12)6-10(7)13)11(15)14-3-4-16-2/h8-10H,1,3-6H2,2H3,(H,14,15) |
| InChIKey | VKEYZOKSUJBJOC-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.71 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|