C17H14F4N4O — CID 91580750
1-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]-3-(1-methylindazol-3-yl)urea (PubChem CID 91580750) has the molecular formula C17H14F4N4O and a molecular weight of 366.32 g/mol. Its IUPAC name is 1-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]-3-(1-methylindazol-3-yl)urea.
| Compound Name | 1-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]-3-(1-methylindazol-3-yl)urea |
|---|---|
| PubChem CID | 91580750 |
| Molecular Formula | C17H14F4N4O |
| Molecular Weight | 366.32 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 1-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]-3-(1-methylindazol-3-yl)urea |
| SMILES | Cn1nc(NC(=O)NCc2ccc(F)c(C(F)(F)F)c2)c2ccccc21 |
| InChI | InChI=1S/C17H14F4N4O/c1-25-14-5-3-2-4-11(14)15(24-25)23-16(26)22-9-10-6-7-13(18)12(8-10)17(19,20)21/h2-8H,9H2,1H3,(H2,22,23,24,26) |
| InChIKey | VQCXWSOMTBFXBW-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.32 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |