About 2-[3-(3-fluoroanilino)-6,7-dimethoxy-1H-indeno[1,2-c]pyrazol-2-yl]ethanol
2-[3-(3-fluoroanilino)-6,7-dimethoxy-1H-indeno[1,2-c]pyrazol-2-yl]ethanol (PubChem CID 91580961) has the molecular formula C20H20FN3O3
and a molecular weight of 369.40 g/mol. Its IUPAC name is 2-[3-(3-fluoroanilino)-6,7-dimethoxy-1H-indeno[1,2-c]pyrazol-2-yl]ethanol.
Molecular Properties
| Compound Name | 2-[3-(3-fluoroanilino)-6,7-dimethoxy-1H-indeno[1,2-c]pyrazol-2-yl]ethanol |
| PubChem CID | 91580961 |
| Molecular Formula | C20H20FN3O3 |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 2-[3-(3-fluoroanilino)-6,7-dimethoxy-1H-indeno[1,2-c]pyrazol-2-yl]ethanol |
| SMILES | COc1cc2cc3c(Nc4cccc(F)c4)n(CCO)[nH]c-3c2cc1OC |
| InChI | InChI=1S/C20H20FN3O3/c1-26-17-9-12-8-16-19(15(12)11-18(17)27-2)23-24(6-7-25)20(16)22-14-5-3-4-13(21)10-14/h3-5,8-11,22-23,25H,6-7H2,1-2H3 |
| InChIKey | NQNNEEZFLNBEIJ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[3-(3-fluoroanilino)-6,7-dimethoxy-1H-indeno[1,2-c]pyrazol-2-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(3-fluoroanilino)-6,7-dimethoxy-1H-indeno[1,2-c]pyrazol-2-yl]ethanol?
The IUPAC name of 2-[3-(3-fluoroanilino)-6,7-dimethoxy-1H-indeno[1,2-c]pyrazol-2-yl]ethanol (CID 91580961) is 2-[3-(3-fluoroanilino)-6,7-dimethoxy-1H-indeno[1,2-c]pyrazol-2-yl]ethanol.
What is the SMILES notation for 2-[3-(3-fluoroanilino)-6,7-dimethoxy-1H-indeno[1,2-c]pyrazol-2-yl]ethanol?
The canonical SMILES for 2-[3-(3-fluoroanilino)-6,7-dimethoxy-1H-indeno[1,2-c]pyrazol-2-yl]ethanol is COc1cc2cc3c(Nc4cccc(F)c4)n(CCO)[nH]c-3c2cc1OC.
What is the InChIKey of 2-[3-(3-fluoroanilino)-6,7-dimethoxy-1H-indeno[1,2-c]pyrazol-2-yl]ethanol?
The InChIKey is NQNNEEZFLNBEIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20FN3O3/c1-26-17-9-12-8-16-19(15(12)11-18(17)27-2)23-24(6-7-25)20(16)22-14-5-3-4-13(21)10-14/h3-5,8-11,22-23,25H,6-7H2,1-2H3.
What are the key properties of 2-[3-(3-fluoroanilino)-6,7-dimethoxy-1H-indeno[1,2-c]pyrazol-2-yl]ethanol?
2-[3-(3-fluoroanilino)-6,7-dimethoxy-1H-indeno[1,2-c]pyrazol-2-yl]ethanol has a molecular weight of 369.40 g/mol, XLogP of 3.97, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(3-fluoroanilino)-6,7-dimethoxy-1H-indeno[1,2-c]pyrazol-2-yl]ethanol is sourced from PubChem (CID 91580961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).