C13H6F6S2 — CID 91581181
2-(2,3,4,4,5,5-hexafluoro-1-thiophen-2-ylcyclopent-2-en-1-yl)thiophene (PubChem CID 91581181) has the molecular formula C13H6F6S2 and a molecular weight of 340.31 g/mol. Its IUPAC name is 2-(2,3,4,4,5,5-hexafluoro-1-thiophen-2-ylcyclopent-2-en-1-yl)thiophene.
| Compound Name | 2-(2,3,4,4,5,5-hexafluoro-1-thiophen-2-ylcyclopent-2-en-1-yl)thiophene |
|---|---|
| PubChem CID | 91581181 |
| Molecular Formula | C13H6F6S2 |
| Molecular Weight | 340.31 g/mol |
| Exact Mass | 339.98 |
| IUPAC Name | 2-(2,3,4,4,5,5-hexafluoro-1-thiophen-2-ylcyclopent-2-en-1-yl)thiophene |
| SMILES | FC1=C(F)C(c2cccs2)(c2cccs2)C(F)(F)C1(F)F |
| InChI | InChI=1S/C13H6F6S2/c14-9-10(15)12(16,17)13(18,19)11(9,7-3-1-5-20-7)8-4-2-6-21-8/h1-6H |
| InChIKey | ODLAKZPPCZHQTB-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.31 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|