C35H51NO11 — CID 91581287
[11-ethyl-5,7,14-trihydroxy-6,16,18-trimethoxy-8-(1-methoxyethoxy)-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] benzoate (PubChem CID 91581287) has the molecular formula C35H51NO11 and a molecular weight of 661.79 g/mol. Its IUPAC name is [11-ethyl-5,7,14-trihydroxy-6,16,18-trimethoxy-8-(1-methoxyethoxy)-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] benzoate.
| Compound Name | [11-ethyl-5,7,14-trihydroxy-6,16,18-trimethoxy-8-(1-methoxyethoxy)-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] benzoate |
|---|---|
| PubChem CID | 91581287 |
| Molecular Formula | C35H51NO11 |
| Molecular Weight | 661.79 g/mol |
| Exact Mass | 661.35 |
| IUPAC Name | [11-ethyl-5,7,14-trihydroxy-6,16,18-trimethoxy-8-(1-methoxyethoxy)-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] benzoate |
| SMILES | CCN1CC2(COC)C(O)CC(OC)C34C5CC6(O)C(OC)C(O)C(OC(C)OC)(C5C6OC(=O)c5ccccc5)C(C(OC)C23)C14 |
| InChI | InChI=1S/C35H51NO11/c1-8-36-16-32(17-41-3)21(37)14-22(43-5)34-20-15-33(40)29(46-31(39)19-12-10-9-11-13-19)23(20)35(47-18(2)42-4,28(38)30(33)45-7)24(27(34)36)25(44-6)26(32)34/h9-13,18,20-30,37-38,40H,8,14-17H2,1-7H3 |
| InChIKey | IQKCDJLPOUHVSH-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 145.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.79 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|