About 2,3-dimethyl-5-methylidene-4H-pyridine;ethane
2,3-dimethyl-5-methylidene-4H-pyridine;ethane (PubChem CID 91581302) has the molecular formula C10H17N
and a molecular weight of 151.25 g/mol. Its IUPAC name is 2,3-dimethyl-5-methylidene-4H-pyridine;ethane.
Molecular Properties
| Compound Name | 2,3-dimethyl-5-methylidene-4H-pyridine;ethane |
| PubChem CID | 91581302 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 2,3-dimethyl-5-methylidene-4H-pyridine;ethane |
| SMILES | C=C1C=NC(C)=C(C)C1.CC |
| InChI | InChI=1S/C8H11N.C2H6/c1-6-4-7(2)8(3)9-5-6;1-2/h5H,1,4H2,2-3H3;1-2H3 |
| InChIKey | IMVAZUJEHKKLJR-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3-dimethyl-5-methylidene-4H-pyridine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-5-methylidene-4H-pyridine;ethane?
The IUPAC name of 2,3-dimethyl-5-methylidene-4H-pyridine;ethane (CID 91581302) is 2,3-dimethyl-5-methylidene-4H-pyridine;ethane.
What is the SMILES notation for 2,3-dimethyl-5-methylidene-4H-pyridine;ethane?
The canonical SMILES for 2,3-dimethyl-5-methylidene-4H-pyridine;ethane is C=C1C=NC(C)=C(C)C1.CC.
What is the InChIKey of 2,3-dimethyl-5-methylidene-4H-pyridine;ethane?
The InChIKey is IMVAZUJEHKKLJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N.C2H6/c1-6-4-7(2)8(3)9-5-6;1-2/h5H,1,4H2,2-3H3;1-2H3.
What are the key properties of 2,3-dimethyl-5-methylidene-4H-pyridine;ethane?
2,3-dimethyl-5-methylidene-4H-pyridine;ethane has a molecular weight of 151.25 g/mol, XLogP of 3.34, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-5-methylidene-4H-pyridine;ethane is sourced from PubChem (CID 91581302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).