C23H39NO2 — CID 91581368
(2S)-2-(icosa-5,8,11,14-tetraenylamino)propanoic acid (PubChem CID 91581368) has the molecular formula C23H39NO2 and a molecular weight of 361.57 g/mol. Its IUPAC name is (2S)-2-(icosa-5,8,11,14-tetraenylamino)propanoic acid.
| Compound Name | (2S)-2-(icosa-5,8,11,14-tetraenylamino)propanoic acid |
|---|---|
| PubChem CID | 91581368 |
| Molecular Formula | C23H39NO2 |
| Molecular Weight | 361.57 g/mol |
| Exact Mass | 361.30 |
| IUPAC Name | (2S)-2-(icosa-5,8,11,14-tetraenylamino)propanoic acid |
| SMILES | CCCCCC=CCC=CCC=CCC=CCCCCN[C@@H](C)C(=O)O |
| InChI | InChI=1S/C23H39NO2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-24-22(2)23(25)26/h7-8,10-11,13-14,16-17,22,24H,3-6,9,12,15,18-21H2,1-2H3,(H,25,26)/t22-/m0/s1 |
| InChIKey | ZMBYGVKXTACGHR-QFIPXVFZSA-N |
| XLogP | 6.19 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.57 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|