C21H27N5O6 — CID 91581820
8-(cyclopentylamino)-7-methyl-10-(2,3,4,5-tetrahydroxypentyl)benzo[g]pteridine-2,4-dione (PubChem CID 91581820) has the molecular formula C21H27N5O6 and a molecular weight of 445.48 g/mol. Its IUPAC name is 8-(cyclopentylamino)-7-methyl-10-(2,3,4,5-tetrahydroxypentyl)benzo[g]pteridine-2,4-dione.
| Compound Name | 8-(cyclopentylamino)-7-methyl-10-(2,3,4,5-tetrahydroxypentyl)benzo[g]pteridine-2,4-dione |
|---|---|
| PubChem CID | 91581820 |
| Molecular Formula | C21H27N5O6 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 8-(cyclopentylamino)-7-methyl-10-(2,3,4,5-tetrahydroxypentyl)benzo[g]pteridine-2,4-dione |
| SMILES | Cc1cc2nc3c(=O)[nH]c(=O)nc-3n(CC(O)C(O)C(O)CO)c2cc1NC1CCCC1 |
| InChI | InChI=1S/C21H27N5O6/c1-10-6-13-14(7-12(10)22-11-4-2-3-5-11)26(8-15(28)18(30)16(29)9-27)19-17(23-13)20(31)25-21(32)24-19/h6-7,11,15-16,18,22,27-30H,2-5,8-9H2,1H3,(H,25,31,32) |
| InChIKey | QVUXOQLTEYSJJT-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 173.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|